About [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate
[(3S)-3,7-dimethyloct-6-enyl] methanesulfonate (PubChem CID 12016919) has the molecular formula C11H22O3S
and a molecular weight of 234.36 g/mol. Its IUPAC name is [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate.
Molecular Properties
| Compound Name | [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate |
| PubChem CID | 12016919 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate |
| SMILES | CC(C)=CCC[C@H](C)CCOS(C)(=O)=O |
| InChI | InChI=1S/C11H22O3S/c1-10(2)6-5-7-11(3)8-9-14-15(4,12)13/h6,11H,5,7-9H2,1-4H3/t11-/m0/s1 |
| InChIKey | REOTWSUDNJILTP-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate?
The IUPAC name of [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate (CID 12016919) is [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate.
What is the SMILES notation for [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate?
The canonical SMILES for [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate is CC(C)=CCC[C@H](C)CCOS(C)(=O)=O.
What is the InChIKey of [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate?
The InChIKey is REOTWSUDNJILTP-NSHDSACASA-N. The full InChI is InChI=1S/C11H22O3S/c1-10(2)6-5-7-11(3)8-9-14-15(4,12)13/h6,11H,5,7-9H2,1-4H3/t11-/m0/s1.
What are the key properties of [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate?
[(3S)-3,7-dimethyloct-6-enyl] methanesulfonate has a molecular weight of 234.36 g/mol, XLogP of 2.74, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3,7-dimethyloct-6-enyl] methanesulfonate is sourced from PubChem (CID 12016919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).