C6H9F5O3S — CID 12017056
4,4,5,5,5-pentafluoropentyl methanesulfonate (PubChem CID 12017056) has the molecular formula C6H9F5O3S and a molecular weight of 256.19 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoropentyl methanesulfonate.
| Compound Name | 4,4,5,5,5-pentafluoropentyl methanesulfonate |
|---|---|
| PubChem CID | 12017056 |
| Molecular Formula | C6H9F5O3S |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4,4,5,5,5-pentafluoropentyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H9F5O3S/c1-15(12,13)14-4-2-3-5(7,8)6(9,10)11/h2-4H2,1H3 |
| InChIKey | MFRVGMDZPRZPDM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|