About quinolin-4-ylmethanamine
quinolin-4-ylmethanamine (PubChem CID 12017326) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is quinolin-4-ylmethanamine.
Molecular Properties
| Compound Name | quinolin-4-ylmethanamine |
| PubChem CID | 12017326 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | quinolin-4-ylmethanamine |
| SMILES | NCc1ccnc2ccccc12 |
| InChI | InChI=1S/C10H10N2/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-6H,7,11H2 |
| InChIKey | BVQGQPVMVBOTID-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-4-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-4-ylmethanamine?
The IUPAC name of quinolin-4-ylmethanamine (CID 12017326) is quinolin-4-ylmethanamine.
What is the SMILES notation for quinolin-4-ylmethanamine?
The canonical SMILES for quinolin-4-ylmethanamine is NCc1ccnc2ccccc12.
What is the InChIKey of quinolin-4-ylmethanamine?
The InChIKey is BVQGQPVMVBOTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-6H,7,11H2.
What are the key properties of quinolin-4-ylmethanamine?
quinolin-4-ylmethanamine has a molecular weight of 158.20 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-4-ylmethanamine is sourced from PubChem (CID 12017326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).