C33H31NO5S — CID 12017338
5-[4-[3-[4-(4-phenylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione (PubChem CID 12017338) has the molecular formula C33H31NO5S and a molecular weight of 553.68 g/mol. Its IUPAC name is 5-[4-[3-[4-(4-phenylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[4-[3-[4-(4-phenylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 12017338 |
| Molecular Formula | C33H31NO5S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 5-[4-[3-[4-(4-phenylphenoxy)-2-propylphenoxy]propoxy]phenyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCc1cc(Oc2ccc(-c3ccccc3)cc2)ccc1OCCCOc1ccc(C2SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C33H31NO5S/c1-2-7-26-22-29(39-28-16-10-24(11-17-28)23-8-4-3-5-9-23)18-19-30(26)38-21-6-20-37-27-14-12-25(13-15-27)31-32(35)34-33(36)40-31/h3-5,8-19,22,31H,2,6-7,20-21H2,1H3,(H,34,35,36) |
| InChIKey | GBIOHEUFDWLGGW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|