C13H22O3 — CID 12017361
(4E,6E)-9-(1,3-dioxolan-2-yl)-7-methylnona-4,6-dien-1-ol (PubChem CID 12017361) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (4E,6E)-9-(1,3-dioxolan-2-yl)-7-methylnona-4,6-dien-1-ol.
| Compound Name | (4E,6E)-9-(1,3-dioxolan-2-yl)-7-methylnona-4,6-dien-1-ol |
|---|---|
| PubChem CID | 12017361 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (4E,6E)-9-(1,3-dioxolan-2-yl)-7-methylnona-4,6-dien-1-ol |
| SMILES | C/C(=C\C=C\CCCO)CCC1OCCO1 |
| InChI | InChI=1S/C13H22O3/c1-12(6-4-2-3-5-9-14)7-8-13-15-10-11-16-13/h2,4,6,13-14H,3,5,7-11H2,1H3/b4-2+,12-6+ |
| InChIKey | FSBZDHHKCCVLBI-MMVJQRGCSA-N |
| XLogP | 2.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|