About 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine
2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 12017580) has the molecular formula C13H18N2O
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| PubChem CID | 12017580 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | COc1cccc2c(CCN(C)C)c[nH]c12 |
| InChI | InChI=1S/C13H18N2O/c1-15(2)8-7-10-9-14-13-11(10)5-4-6-12(13)16-3/h4-6,9,14H,7-8H2,1-3H3 |
| InChIKey | GCEZYLSUTMYNRN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine (CID 12017580) is 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine is COc1cccc2c(CCN(C)C)c[nH]c12.
What is the InChIKey of 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine?
The InChIKey is GCEZYLSUTMYNRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O/c1-15(2)8-7-10-9-14-13-11(10)5-4-6-12(13)16-3/h4-6,9,14H,7-8H2,1-3H3.
What are the key properties of 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine?
2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine has a molecular weight of 218.30 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 12017580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).