C31H40N6O6 — CID 12017854
methyl 4-[[(2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]pyrrolidine-2-carbonyl]-benzylamino]benzoate (PubChem CID 12017854) has the molecular formula C31H40N6O6 and a molecular weight of 592.70 g/mol. Its IUPAC name is methyl 4-[[(2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]pyrrolidine-2-carbonyl]-benzylamino]benzoate.
| Compound Name | methyl 4-[[(2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]pyrrolidine-2-carbonyl]-benzylamino]benzoate |
|---|---|
| PubChem CID | 12017854 |
| Molecular Formula | C31H40N6O6 |
| Molecular Weight | 592.70 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | methyl 4-[[(2S,4S)-4-azido-1-[(2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]pyrrolidine-2-carbonyl]-benzylamino]benzoate |
| SMILES | COC(=O)c1ccc(N(Cc2ccccc2)C(=O)[C@@H]2C[C@H](N=[N+]=[N-])CN2C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H40N6O6/c1-30(2,3)25(33-29(41)43-31(4,5)6)27(39)37-19-22(34-35-32)17-24(37)26(38)36(18-20-11-9-8-10-12-20)23-15-13-21(14-16-23)28(40)42-7/h8-16,22,24-25H,17-19H2,1-7H3,(H,33,41)/t22-,24-,25+/m0/s1 |
| InChIKey | BSYIAKYSSURBSH-ZKMPZPQNSA-N |
| XLogP | 5.23 |
| TPSA | 154.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.70 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|