C13H26N2OS — CID 12018504
1-(2-hydroxyethyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea (PubChem CID 12018504) has the molecular formula C13H26N2OS and a molecular weight of 258.43 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea.
| Compound Name | 1-(2-hydroxyethyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 12018504 |
| Molecular Formula | C13H26N2OS |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]thiourea |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1NC(=S)NCCO |
| InChI | InChI=1S/C13H26N2OS/c1-9(2)11-5-4-10(3)8-12(11)15-13(17)14-6-7-16/h9-12,16H,4-8H2,1-3H3,(H2,14,15,17)/t10-,11+,12-/m1/s1 |
| InChIKey | UUPDBKUCZCWYAV-GRYCIOLGSA-N |
| XLogP | 1.90 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|