C35H43N7O2 — CID 12018534
N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide (PubChem CID 12018534) has the molecular formula C35H43N7O2 and a molecular weight of 593.78 g/mol. Its IUPAC name is N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide.
| Compound Name | N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 12018534 |
| Molecular Formula | C35H43N7O2 |
| Molecular Weight | 593.78 g/mol |
| Exact Mass | 593.35 |
| IUPAC Name | N-[4-(4-amino-2-butylimidazo[4,5-c][1,5]naphthyridin-1-yl)butyl]-4-[2-(dimethylamino)ethoxy-phenylmethyl]benzamide |
| SMILES | CCCCc1nc2c(N)nc3cccnc3c2n1CCCCNC(=O)c1ccc(C(OCCN(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H43N7O2/c1-4-5-15-29-40-31-32(30-28(39-34(31)36)14-11-21-37-30)42(29)22-10-9-20-38-35(43)27-18-16-26(17-19-27)33(44-24-23-41(2)3)25-12-7-6-8-13-25/h6-8,11-14,16-19,21,33H,4-5,9-10,15,20,22-24H2,1-3H3,(H2,36,39)(H,38,43) |
| InChIKey | WGEBPQSOKKDNEO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.78 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|