C29H26N4O5 — CID 12018751
3-methylbutyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 12018751) has the molecular formula C29H26N4O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is 3-methylbutyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 3-methylbutyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 12018751 |
| Molecular Formula | C29H26N4O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 3-methylbutyl 1-(7-acetamido-5,8-dioxoquinolin-2-yl)-4-methyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(=O)NC1=CC(=O)c2ccc(-c3nc(C(=O)OCCC(C)C)c(C)c4c3[nH]c3ccccc34)nc2C1=O |
| InChI | InChI=1S/C29H26N4O5/c1-14(2)11-12-38-29(37)24-15(3)23-17-7-5-6-8-19(17)31-27(23)26(33-24)20-10-9-18-22(35)13-21(30-16(4)34)28(36)25(18)32-20/h5-10,13-14,31H,11-12H2,1-4H3,(H,30,34) |
| InChIKey | GXWWZCUECQZYEN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|