About (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one
(3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one (PubChem CID 12019563) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one.
Molecular Properties
| Compound Name | (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one |
| PubChem CID | 12019563 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one |
| SMILES | O=C1C=C[C@@H](O)CN1 |
| InChI | InChI=1S/C5H7NO2/c7-4-1-2-5(8)6-3-4/h1-2,4,7H,3H2,(H,6,8)/t4-/m1/s1 |
| InChIKey | OJUNZJSEHXGBLM-SCSAIBSYSA-N |
| XLogP | -0.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one?
The IUPAC name of (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one (CID 12019563) is (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one.
What is the SMILES notation for (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one?
The canonical SMILES for (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one is O=C1C=C[C@@H](O)CN1.
What is the InChIKey of (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one?
The InChIKey is OJUNZJSEHXGBLM-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H7NO2/c7-4-1-2-5(8)6-3-4/h1-2,4,7H,3H2,(H,6,8)/t4-/m1/s1.
What are the key properties of (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one?
(3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one has a molecular weight of 113.12 g/mol, XLogP of -0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-hydroxy-2,3-dihydro-1H-pyridin-6-one is sourced from PubChem (CID 12019563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).