C30H56O7SSi2 — CID 12019917
[(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-hydroxyhex-5-enyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 12019917) has the molecular formula C30H56O7SSi2 and a molecular weight of 617.01 g/mol. Its IUPAC name is [(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-hydroxyhex-5-enyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-hydroxyhex-5-enyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 12019917 |
| Molecular Formula | C30H56O7SSi2 |
| Molecular Weight | 617.01 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | [(2R,3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-2-hydroxyhex-5-enyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OCCCO[Si](C)(C)C(C)(C)C)[C@H](O)COS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C30H56O7SSi2/c1-15-26(37-40(13,14)30(8,9)10)27(34-17-16-18-36-39(11,12)29(5,6)7)25(31)21-35-38(32,33)28-23(3)19-22(2)20-24(28)4/h15,19-20,25-27,31H,1,16-18,21H2,2-14H3/t25-,26-,27+/m1/s1 |
| InChIKey | IEVRQYCUKZZJJF-PFBJBMPXSA-N |
| XLogP | 7.05 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.01 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|