C23H46O4Si2 — CID 12019920
(4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]oct-7-en-1-yn-4-ol (PubChem CID 12019920) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is (4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]oct-7-en-1-yn-4-ol.
| Compound Name | (4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]oct-7-en-1-yn-4-ol |
|---|---|
| PubChem CID | 12019920 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (4R,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]oct-7-en-1-yn-4-ol |
| SMILES | C#CC[C@@H](O)[C@H](OCCCO[Si](C)(C)C(C)(C)C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O4Si2/c1-13-16-19(24)21(20(14-2)27-29(11,12)23(6,7)8)25-17-15-18-26-28(9,10)22(3,4)5/h1,14,19-21,24H,2,15-18H2,3-12H3/t19-,20-,21+/m1/s1 |
| InChIKey | HZNSCNWLUAIKHD-NJYVYQBISA-N |
| XLogP | 5.74 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|