C31H35IN2O3 — CID 12020164
4-[[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]methyl]-N-[(1R)-1-(4-iodophenyl)butyl]benzamide (PubChem CID 12020164) has the molecular formula C31H35IN2O3 and a molecular weight of 610.54 g/mol. Its IUPAC name is 4-[[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]methyl]-N-[(1R)-1-(4-iodophenyl)butyl]benzamide.
| Compound Name | 4-[[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]methyl]-N-[(1R)-1-(4-iodophenyl)butyl]benzamide |
|---|---|
| PubChem CID | 12020164 |
| Molecular Formula | C31H35IN2O3 |
| Molecular Weight | 610.54 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | 4-[[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]methyl]-N-[(1R)-1-(4-iodophenyl)butyl]benzamide |
| SMILES | CCC[C@@H](NC(=O)c1ccc(CC2CCN(Cc3ccc4c(c3)OCO4)CC2)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C31H35IN2O3/c1-2-3-28(25-9-11-27(32)12-10-25)33-31(35)26-7-4-22(5-8-26)18-23-14-16-34(17-15-23)20-24-6-13-29-30(19-24)37-21-36-29/h4-13,19,23,28H,2-3,14-18,20-21H2,1H3,(H,33,35)/t28-/m1/s1 |
| InChIKey | JTLLRYVMISHCKH-MUUNZHRXSA-N |
| XLogP | 6.75 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|