C20H39IOSi — CID 12020621
[(1R,3aR,4S,7aR)-1-[(2R)-4-iodobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane (PubChem CID 12020621) has the molecular formula C20H39IOSi and a molecular weight of 450.52 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2R)-4-iodobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2R)-4-iodobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 12020621 |
| Molecular Formula | C20H39IOSi |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2R)-4-iodobutan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)CCI)CC[C@@H]12 |
| InChI | InChI=1S/C20H39IOSi/c1-6-23(7-2,8-3)22-19-10-9-14-20(5)17(11-12-18(19)20)16(4)13-15-21/h16-19H,6-15H2,1-5H3/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | LOCQFPRPLLISJK-SWBPCFCJSA-N |
| XLogP | 7.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|