C21H26O6 — CID 12020879
(1S,4S,8S,9R,12S,13R,15R,17R)-9-hydroxy-10-(hydroxymethyl)-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione (PubChem CID 12020879) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is (1S,4S,8S,9R,12S,13R,15R,17R)-9-hydroxy-10-(hydroxymethyl)-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione.
| Compound Name | (1S,4S,8S,9R,12S,13R,15R,17R)-9-hydroxy-10-(hydroxymethyl)-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione |
|---|---|
| PubChem CID | 12020879 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (1S,4S,8S,9R,12S,13R,15R,17R)-9-hydroxy-10-(hydroxymethyl)-3,14,14,17-tetramethyl-5,7-dioxapentacyclo[10.5.1.01,8.04,8.013,15]octadeca-2,10-diene-6,18-dione |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C(CO)[C@@H](O)[C@@]24OC(=O)O[C@@H]14)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C21H26O6/c1-9-7-20-10(2)5-13-14(19(13,3)4)12(16(20)24)6-11(8-22)15(23)21(20)17(9)26-18(25)27-21/h6-7,10,12-15,17,22-23H,5,8H2,1-4H3/t10-,12+,13-,14+,15-,17+,20+,21+/m1/s1 |
| InChIKey | TVZHSJOSQQVAMG-WJIZMMCPSA-N |
| XLogP | 2.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|