C39H68O4Si2 — CID 12020963
ethyl (5S)-5-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate (PubChem CID 12020963) has the molecular formula C39H68O4Si2 and a molecular weight of 657.14 g/mol. Its IUPAC name is ethyl (5S)-5-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate.
| Compound Name | ethyl (5S)-5-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate |
|---|---|
| PubChem CID | 12020963 |
| Molecular Formula | C39H68O4Si2 |
| Molecular Weight | 657.14 g/mol |
| Exact Mass | 656.47 |
| IUPAC Name | ethyl (5S)-5-[(1S,3R,9S,10R,13S,14S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hexanoate |
| SMILES | CCOC(=O)CCC[C@H](C)C1=CC[C@H]2C3=CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C39H68O4Si2/c1-15-41-35(40)18-16-17-27(2)31-21-22-32-30-20-19-28-25-29(42-44(11,12)36(3,4)5)26-34(43-45(13,14)37(6,7)8)39(28,10)33(30)23-24-38(31,32)9/h19-21,27,29,32-34H,15-18,22-26H2,1-14H3/t27-,29+,32-,33-,34-,38+,39-/m0/s1 |
| InChIKey | GQBNRNKTVPQQNM-NPCFOWJXSA-N |
| XLogP | 11.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.14 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|