About 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine
1-butan-2-yl-5-chloro-3,3-dimethylpiperidine (PubChem CID 12021737) has the molecular formula C11H22ClN
and a molecular weight of 203.76 g/mol. Its IUPAC name is 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine |
| PubChem CID | 12021737 |
| Molecular Formula | C11H22ClN |
| Molecular Weight | 203.76 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine |
| SMILES | CCC(C)N1CC(Cl)CC(C)(C)C1 |
| InChI | InChI=1S/C11H22ClN/c1-5-9(2)13-7-10(12)6-11(3,4)8-13/h9-10H,5-8H2,1-4H3 |
| InChIKey | HRJHSULFYUDYTQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.76 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine?
The IUPAC name of 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine (CID 12021737) is 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine.
What is the SMILES notation for 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine?
The canonical SMILES for 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine is CCC(C)N1CC(Cl)CC(C)(C)C1.
What is the InChIKey of 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine?
The InChIKey is HRJHSULFYUDYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22ClN/c1-5-9(2)13-7-10(12)6-11(3,4)8-13/h9-10H,5-8H2,1-4H3.
What are the key properties of 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine?
1-butan-2-yl-5-chloro-3,3-dimethylpiperidine has a molecular weight of 203.76 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-5-chloro-3,3-dimethylpiperidine is sourced from PubChem (CID 12021737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).