C20H20ClFN6O — CID 1202188
4-chloro-N-(4-fluorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine (PubChem CID 1202188) has the molecular formula C20H20ClFN6O and a molecular weight of 414.87 g/mol. Its IUPAC name is 4-chloro-N-(4-fluorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(4-fluorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1202188 |
| Molecular Formula | C20H20ClFN6O |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 4-chloro-N-(4-fluorophenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(N2CCN(c3nc(Cl)nc(Nc4ccc(F)cc4)n3)CC2)cc1 |
| InChI | InChI=1S/C20H20ClFN6O/c1-29-17-8-6-16(7-9-17)27-10-12-28(13-11-27)20-25-18(21)24-19(26-20)23-15-4-2-14(22)3-5-15/h2-9H,10-13H2,1H3,(H,23,24,25,26) |
| InChIKey | UPGPCOREBWFJLY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|