C17H20N2O — CID 12021955
(5S)-2,2,3-trimethyl-5-(naphthalen-2-ylmethyl)imidazolidin-4-one (PubChem CID 12021955) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (5S)-2,2,3-trimethyl-5-(naphthalen-2-ylmethyl)imidazolidin-4-one.
| Compound Name | (5S)-2,2,3-trimethyl-5-(naphthalen-2-ylmethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 12021955 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (5S)-2,2,3-trimethyl-5-(naphthalen-2-ylmethyl)imidazolidin-4-one |
| SMILES | CN1C(=O)[C@H](Cc2ccc3ccccc3c2)NC1(C)C |
| InChI | InChI=1S/C17H20N2O/c1-17(2)18-15(16(20)19(17)3)11-12-8-9-13-6-4-5-7-14(13)10-12/h4-10,15,18H,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | QKPTVUWGZJEQDN-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |