About [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate
[2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 12022019) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate |
| PubChem CID | 12022019 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | CC(OC(=O)COC(=O)C1CC1)C1CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H26O4/c1-11(13-5-4-8-16(2,3)9-13)20-14(17)10-19-15(18)12-6-7-12/h11-13H,4-10H2,1-3H3 |
| InChIKey | XGOFVAPOTVSKNM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate?
The IUPAC name of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate (CID 12022019) is [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate.
What is the SMILES notation for [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate?
The canonical SMILES for [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate is CC(OC(=O)COC(=O)C1CC1)C1CCCC(C)(C)C1.
What is the InChIKey of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate?
The InChIKey is XGOFVAPOTVSKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4/c1-11(13-5-4-8-16(2,3)9-13)20-14(17)10-19-15(18)12-6-7-12/h11-13H,4-10H2,1-3H3.
What are the key properties of [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate?
[2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate has a molecular weight of 282.38 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,3-dimethylcyclohexyl)ethoxy]-2-oxoethyl] cyclopropanecarboxylate is sourced from PubChem (CID 12022019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).