C8H16O2 — CID 12022119
4-methyl-3-methylidenehexane-1,2-diol (PubChem CID 12022119) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is 4-methyl-3-methylidenehexane-1,2-diol.
| Compound Name | 4-methyl-3-methylidenehexane-1,2-diol |
|---|---|
| PubChem CID | 12022119 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 4-methyl-3-methylidenehexane-1,2-diol |
| SMILES | C=C(C(C)CC)C(O)CO |
| InChI | InChI=1S/C8H16O2/c1-4-6(2)7(3)8(10)5-9/h6,8-10H,3-5H2,1-2H3 |
| InChIKey | PKAOPYYCULNYBC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|