About 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane
1-pentyl-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 12022127) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane |
| PubChem CID | 12022127 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | CCCCCC12COCC1O2 |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-9-7-10-6-8(9)11-9/h8H,2-7H2,1H3 |
| InChIKey | RDBDAKCTIYIZMT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane?
The IUPAC name of 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane (CID 12022127) is 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane.
What is the SMILES notation for 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane?
The canonical SMILES for 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane is CCCCCC12COCC1O2.
What is the InChIKey of 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane?
The InChIKey is RDBDAKCTIYIZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-2-3-4-5-9-7-10-6-8(9)11-9/h8H,2-7H2,1H3.
What are the key properties of 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane?
1-pentyl-3,6-dioxabicyclo[3.1.0]hexane has a molecular weight of 156.22 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-3,6-dioxabicyclo[3.1.0]hexane is sourced from PubChem (CID 12022127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).