About 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate
2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate (PubChem CID 1202228) has the molecular formula C7H6N3O5-
and a molecular weight of 212.14 g/mol. Its IUPAC name is 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate.
Molecular Properties
| Compound Name | 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate |
| PubChem CID | 1202228 |
| Molecular Formula | C7H6N3O5- |
| Molecular Weight | 212.14 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate |
| SMILES | O=C([O-])CNC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H7N3O5/c11-4-1-3(9-7(15)10-4)6(14)8-2-5(12)13/h1H,2H2,(H,8,14)(H,12,13)(H2,9,10,11,15)/p-1 |
| InChIKey | KXUHDDGHQOKAAP-UHFFFAOYSA-M |
| XLogP | -3.46 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.14 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate?
The IUPAC name of 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate (CID 1202228) is 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate.
What is the SMILES notation for 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate?
The canonical SMILES for 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate is O=C([O-])CNC(=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate?
The InChIKey is KXUHDDGHQOKAAP-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7N3O5/c11-4-1-3(9-7(15)10-4)6(14)8-2-5(12)13/h1H,2H2,(H,8,14)(H,12,13)(H2,9,10,11,15)/p-1.
What are the key properties of 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate?
2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate has a molecular weight of 212.14 g/mol, XLogP of -3.46, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]acetate is sourced from PubChem (CID 1202228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).