About 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene
1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene (PubChem CID 12023150) has the molecular formula C14H14
and a molecular weight of 182.27 g/mol. Its IUPAC name is 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene.
Molecular Properties
| Compound Name | 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene |
| PubChem CID | 12023150 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene |
| SMILES | CC#Cc1cc(C)c(C)cc1C#CC |
| InChI | InChI=1S/C14H14/c1-5-7-13-9-11(3)12(4)10-14(13)8-6-2/h9-10H,1-4H3 |
| InChIKey | YZAYZWZNEHRTIU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene?
The IUPAC name of 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene (CID 12023150) is 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene.
What is the SMILES notation for 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene?
The canonical SMILES for 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene is CC#Cc1cc(C)c(C)cc1C#CC.
What is the InChIKey of 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene?
The InChIKey is YZAYZWZNEHRTIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14/c1-5-7-13-9-11(3)12(4)10-14(13)8-6-2/h9-10H,1-4H3.
What are the key properties of 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene?
1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene has a molecular weight of 182.27 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4,5-bis(prop-1-ynyl)benzene is sourced from PubChem (CID 12023150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).