About 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene
4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene (PubChem CID 12023814) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene |
| PubChem CID | 12023814 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene |
| SMILES | C=CCOCC(=C)CC(C)=C(C)C |
| InChI | InChI=1S/C12H20O/c1-6-7-13-9-11(4)8-12(5)10(2)3/h6H,1,4,7-9H2,2-3,5H3 |
| InChIKey | HSVMLGLAAJEFGF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene?
The IUPAC name of 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene (CID 12023814) is 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene.
What is the SMILES notation for 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene?
The canonical SMILES for 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene is C=CCOCC(=C)CC(C)=C(C)C.
What is the InChIKey of 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene?
The InChIKey is HSVMLGLAAJEFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-6-7-13-9-11(4)8-12(5)10(2)3/h6H,1,4,7-9H2,2-3,5H3.
What are the key properties of 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene?
4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene has a molecular weight of 180.29 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(prop-2-enoxymethyl)hexa-1,4-diene is sourced from PubChem (CID 12023814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).