About (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile
(2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile (PubChem CID 12024419) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile.
Molecular Properties
| Compound Name | (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile |
| PubChem CID | 12024419 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile |
| SMILES | CN1C(=O)N/C(=C\C#N)C1=O |
| InChI | InChI=1S/C6H5N3O2/c1-9-5(10)4(2-3-7)8-6(9)11/h2H,1H3,(H,8,11)/b4-2- |
| InChIKey | YCCASFIJHSHVTM-RQOWECAXSA-N |
| XLogP | -0.42 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile?
The IUPAC name of (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile (CID 12024419) is (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile.
What is the SMILES notation for (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile?
The canonical SMILES for (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile is CN1C(=O)N/C(=C\C#N)C1=O.
What is the InChIKey of (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile?
The InChIKey is YCCASFIJHSHVTM-RQOWECAXSA-N. The full InChI is InChI=1S/C6H5N3O2/c1-9-5(10)4(2-3-7)8-6(9)11/h2H,1H3,(H,8,11)/b4-2-.
What are the key properties of (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile?
(2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile has a molecular weight of 151.12 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1-methyl-2,5-dioxoimidazolidin-4-ylidene)acetonitrile is sourced from PubChem (CID 12024419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).