About 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene
2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene (PubChem CID 12024457) has the molecular formula C18H16
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene.
Molecular Properties
| Compound Name | 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene |
| PubChem CID | 12024457 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene |
| SMILES | c1ccc2c(c1)CC(=C1CCc3ccccc31)C2 |
| InChI | InChI=1S/C18H16/c1-2-7-15-12-16(11-14(15)6-1)18-10-9-13-5-3-4-8-17(13)18/h1-8H,9-12H2 |
| InChIKey | FAHJACCOXBAEFA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene?
The IUPAC name of 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene (CID 12024457) is 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene.
What is the SMILES notation for 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene?
The canonical SMILES for 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene is c1ccc2c(c1)CC(=C1CCc3ccccc31)C2.
What is the InChIKey of 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene?
The InChIKey is FAHJACCOXBAEFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16/c1-2-7-15-12-16(11-14(15)6-1)18-10-9-13-5-3-4-8-17(13)18/h1-8H,9-12H2.
What are the key properties of 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene?
2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene has a molecular weight of 232.33 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroinden-1-ylidene)-1,3-dihydroindene is sourced from PubChem (CID 12024457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).