C22H28N2O — CID 1202455
(2S)-1-carbazol-9-yl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol (PubChem CID 1202455) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (2S)-1-carbazol-9-yl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-carbazol-9-yl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 1202455 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (2S)-1-carbazol-9-yl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]propan-2-ol |
| SMILES | C[C@H]1CCC[C@H](C)N1C[C@H](O)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C22H28N2O/c1-16-8-7-9-17(2)23(16)14-18(25)15-24-21-12-5-3-10-19(21)20-11-4-6-13-22(20)24/h3-6,10-13,16-18,25H,7-9,14-15H2,1-2H3/t16-,17-,18-/m0/s1 |
| InChIKey | VPRPANWSSJGICN-BZSNNMDCSA-N |
| XLogP | 4.42 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |