C11H19Br2NO2 — CID 12024557
tert-butyl N-[(3S)-1,1-dibromo-4-methylpent-1-en-3-yl]carbamate (PubChem CID 12024557) has the molecular formula C11H19Br2NO2 and a molecular weight of 357.09 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1,1-dibromo-4-methylpent-1-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1,1-dibromo-4-methylpent-1-en-3-yl]carbamate |
|---|---|
| PubChem CID | 12024557 |
| Molecular Formula | C11H19Br2NO2 |
| Molecular Weight | 357.09 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | tert-butyl N-[(3S)-1,1-dibromo-4-methylpent-1-en-3-yl]carbamate |
| SMILES | CC(C)[C@@H](C=C(Br)Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19Br2NO2/c1-7(2)8(6-9(12)13)14-10(15)16-11(3,4)5/h6-8H,1-5H3,(H,14,15)/t8-/m1/s1 |
| InChIKey | BZSXZDIHFMVJFM-MRVPVSSYSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.09 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |