C16H14ClF2N5O4 — CID 1202473
N-[4-[chloro(difluoro)methoxy]phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide (PubChem CID 1202473) has the molecular formula C16H14ClF2N5O4 and a molecular weight of 413.77 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
|---|---|
| PubChem CID | 1202473 |
| Molecular Formula | C16H14ClF2N5O4 |
| Molecular Weight | 413.77 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetamide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)Nc2ccc(OC(F)(F)Cl)cc2)n(C)c1=O |
| InChI | InChI=1S/C16H14ClF2N5O4/c1-22-13-12(14(26)23(2)15(22)27)24(8-20-13)7-11(25)21-9-3-5-10(6-4-9)28-16(17,18)19/h3-6,8H,7H2,1-2H3,(H,21,25) |
| InChIKey | AWZRZULBJFMNHF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.77 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|