C24H23NO4 — CID 12024775
2-(cyclohexylamino)-3-(4-methoxyphenyl)furo[3,2-c]chromen-4-one (PubChem CID 12024775) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is 2-(cyclohexylamino)-3-(4-methoxyphenyl)furo[3,2-c]chromen-4-one.
| Compound Name | 2-(cyclohexylamino)-3-(4-methoxyphenyl)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 12024775 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2-(cyclohexylamino)-3-(4-methoxyphenyl)furo[3,2-c]chromen-4-one |
| SMILES | COc1ccc(-c2c(NC3CCCCC3)oc3c2c(=O)oc2ccccc23)cc1 |
| InChI | InChI=1S/C24H23NO4/c1-27-17-13-11-15(12-14-17)20-21-22(18-9-5-6-10-19(18)28-24(21)26)29-23(20)25-16-7-3-2-4-8-16/h5-6,9-14,16,25H,2-4,7-8H2,1H3 |
| InChIKey | RHYUGZXTPPLTPM-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 64.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|