About 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol
2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol (PubChem CID 12024896) has the molecular formula C13H10F3N3OS
and a molecular weight of 313.30 g/mol. Its IUPAC name is 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol.
Molecular Properties
| Compound Name | 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| PubChem CID | 12024896 |
| Molecular Formula | C13H10F3N3OS |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol |
| SMILES | OC1(C(F)(F)F)CC=NN1c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C13H10F3N3OS/c14-13(15,16)12(20)6-7-17-19(12)11-18-10(8-21-11)9-4-2-1-3-5-9/h1-5,7-8,20H,6H2 |
| InChIKey | PKXCOAMATRKMRE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
The IUPAC name of 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol (CID 12024896) is 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol.
What is the SMILES notation for 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
The canonical SMILES for 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol is OC1(C(F)(F)F)CC=NN1c1nc(-c2ccccc2)cs1.
What is the InChIKey of 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
The InChIKey is PKXCOAMATRKMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N3OS/c14-13(15,16)12(20)6-7-17-19(12)11-18-10(8-21-11)9-4-2-1-3-5-9/h1-5,7-8,20H,6H2.
What are the key properties of 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol?
2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol has a molecular weight of 313.30 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenyl-1,3-thiazol-2-yl)-3-(trifluoromethyl)-4H-pyrazol-3-ol is sourced from PubChem (CID 12024896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).