C15H10F6N2O2S — CID 12024938
2-(1-benzylsulfonyl-3,3,4,4,5,5-hexafluoropentan-2-ylidene)propanedinitrile (PubChem CID 12024938) has the molecular formula C15H10F6N2O2S and a molecular weight of 396.31 g/mol. Its IUPAC name is 2-(1-benzylsulfonyl-3,3,4,4,5,5-hexafluoropentan-2-ylidene)propanedinitrile.
| Compound Name | 2-(1-benzylsulfonyl-3,3,4,4,5,5-hexafluoropentan-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 12024938 |
| Molecular Formula | C15H10F6N2O2S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-(1-benzylsulfonyl-3,3,4,4,5,5-hexafluoropentan-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C(CS(=O)(=O)Cc1ccccc1)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H10F6N2O2S/c16-13(17)15(20,21)14(18,19)12(11(6-22)7-23)9-26(24,25)8-10-4-2-1-3-5-10/h1-5,13H,8-9H2 |
| InChIKey | PBGSSQXPXFWFMX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|