About methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate
methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate (PubChem CID 12025079) has the molecular formula C18H13N3O2
and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate |
| PubChem CID | 12025079 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate |
| SMILES | COC(=O)c1cc(-c2cn3cccnc3n2)c2cccccc1-2 |
| InChI | InChI=1S/C18H13N3O2/c1-23-17(22)15-10-14(12-6-3-2-4-7-13(12)15)16-11-21-9-5-8-19-18(21)20-16/h2-11H,1H3 |
| InChIKey | KEDJQFVSRMCDAR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate?
The IUPAC name of methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate (CID 12025079) is methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate.
What is the SMILES notation for methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate?
The canonical SMILES for methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate is COC(=O)c1cc(-c2cn3cccnc3n2)c2cccccc1-2.
What is the InChIKey of methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate?
The InChIKey is KEDJQFVSRMCDAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O2/c1-23-17(22)15-10-14(12-6-3-2-4-7-13(12)15)16-11-21-9-5-8-19-18(21)20-16/h2-11H,1H3.
What are the key properties of methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate?
methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate has a molecular weight of 303.32 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-imidazo[1,2-a]pyrimidin-2-ylazulene-1-carboxylate is sourced from PubChem (CID 12025079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).