About methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate
methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate (PubChem CID 12025202) has the molecular formula C14H12FNO4
and a molecular weight of 277.25 g/mol. Its IUPAC name is methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate.
Molecular Properties
| Compound Name | methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate |
| PubChem CID | 12025202 |
| Molecular Formula | C14H12FNO4 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate |
| SMILES | COC(=O)C1(F)CC12CC(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C14H12FNO4/c1-20-12(19)14(15)8-13(14)7-10(17)16(11(13)18)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | YIYNWJXSLGHPAZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate?
The IUPAC name of methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate (CID 12025202) is methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate.
What is the SMILES notation for methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate?
The canonical SMILES for methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate is COC(=O)C1(F)CC12CC(=O)N(c1ccccc1)C2=O.
What is the InChIKey of methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate?
The InChIKey is YIYNWJXSLGHPAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FNO4/c1-20-12(19)14(15)8-13(14)7-10(17)16(11(13)18)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3.
What are the key properties of methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate?
methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate has a molecular weight of 277.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-4,6-dioxo-5-phenyl-5-azaspiro[2.4]heptane-2-carboxylate is sourced from PubChem (CID 12025202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).