C18H25NO4S — CID 12025295
methyl 1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate (PubChem CID 12025295) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is methyl 1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate.
| Compound Name | methyl 1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate |
|---|---|
| PubChem CID | 12025295 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl 1-(4-methylphenyl)sulfonyl-1-azaspiro[4.5]decane-2-carboxylate |
| SMILES | COC(=O)C1CCC2(CCCCC2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO4S/c1-14-6-8-15(9-7-14)24(21,22)19-16(17(20)23-2)10-13-18(19)11-4-3-5-12-18/h6-9,16H,3-5,10-13H2,1-2H3 |
| InChIKey | KIWBDZSCMMUOLH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |