C6H4F10 — CID 12025749
1,1,1,2,2,5,5,6,6,6-decafluorohexane (PubChem CID 12025749) has the molecular formula C6H4F10 and a molecular weight of 266.08 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,6,6,6-decafluorohexane.
| Compound Name | 1,1,1,2,2,5,5,6,6,6-decafluorohexane |
|---|---|
| PubChem CID | 12025749 |
| Molecular Formula | C6H4F10 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 1,1,1,2,2,5,5,6,6,6-decafluorohexane |
| SMILES | FC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F10/c7-3(8,5(11,12)13)1-2-4(9,10)6(14,15)16/h1-2H2 |
| InChIKey | FUCPNELYUCUXTJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|