C16H16N2O — CID 1202583
(5S)-4,5-dimethyl-3,5-diphenyl-1,2,4-oxadiazole (PubChem CID 1202583) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (5S)-4,5-dimethyl-3,5-diphenyl-1,2,4-oxadiazole.
| Compound Name | (5S)-4,5-dimethyl-3,5-diphenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1202583 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (5S)-4,5-dimethyl-3,5-diphenyl-1,2,4-oxadiazole |
| SMILES | CN1C(c2ccccc2)=NO[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C16H16N2O/c1-16(14-11-7-4-8-12-14)18(2)15(17-19-16)13-9-5-3-6-10-13/h3-12H,1-2H3/t16-/m0/s1 |
| InChIKey | TXEAQKHSZUDTDA-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |