C11H20O4S — CID 12026222
ethyl (2R,3R)-4-tert-butylsulfanyl-2-hydroxy-3-methyl-4-oxobutanoate (PubChem CID 12026222) has the molecular formula C11H20O4S and a molecular weight of 248.34 g/mol. Its IUPAC name is ethyl (2R,3R)-4-tert-butylsulfanyl-2-hydroxy-3-methyl-4-oxobutanoate.
| Compound Name | ethyl (2R,3R)-4-tert-butylsulfanyl-2-hydroxy-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 12026222 |
| Molecular Formula | C11H20O4S |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | ethyl (2R,3R)-4-tert-butylsulfanyl-2-hydroxy-3-methyl-4-oxobutanoate |
| SMILES | CCOC(=O)[C@H](O)[C@@H](C)C(=O)SC(C)(C)C |
| InChI | InChI=1S/C11H20O4S/c1-6-15-9(13)8(12)7(2)10(14)16-11(3,4)5/h7-8,12H,6H2,1-5H3/t7-,8-/m1/s1 |
| InChIKey | QOVFJIWJEBLOLJ-HTQZYQBOSA-N |
| XLogP | 1.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|