C13H24O4 — CID 12026280
6-tert-butylperoxy-4,6-dimethylhept-2-yne-1,4-diol (PubChem CID 12026280) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 6-tert-butylperoxy-4,6-dimethylhept-2-yne-1,4-diol.
| Compound Name | 6-tert-butylperoxy-4,6-dimethylhept-2-yne-1,4-diol |
|---|---|
| PubChem CID | 12026280 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 6-tert-butylperoxy-4,6-dimethylhept-2-yne-1,4-diol |
| SMILES | CC(O)(C#CCO)CC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C13H24O4/c1-11(2,3)16-17-12(4,5)10-13(6,15)8-7-9-14/h14-15H,9-10H2,1-6H3 |
| InChIKey | UETPLLXPCVSBEQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|