C18H19NO2 — CID 12026321
(5S,6R)-6-ethoxy-3,5-diphenyl-5,6-dihydro-4H-oxazine (PubChem CID 12026321) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (5S,6R)-6-ethoxy-3,5-diphenyl-5,6-dihydro-4H-oxazine.
| Compound Name | (5S,6R)-6-ethoxy-3,5-diphenyl-5,6-dihydro-4H-oxazine |
|---|---|
| PubChem CID | 12026321 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (5S,6R)-6-ethoxy-3,5-diphenyl-5,6-dihydro-4H-oxazine |
| SMILES | CCO[C@@H]1ON=C(c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-2-20-18-16(14-9-5-3-6-10-14)13-17(19-21-18)15-11-7-4-8-12-15/h3-12,16,18H,2,13H2,1H3/t16-,18+/m0/s1 |
| InChIKey | KFSMPFBDSPNCRT-FUHWJXTLSA-N |
| XLogP | 3.96 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |