C32H26NO3P — CID 12026596
(5Z)-5-[hydroxy(phenyl)methylidene]-10b-phenyl-3-(2,4,6-trimethylphenyl)isophosphinolino[2,1-d][1,2,4]oxazaphosphol-6-one (PubChem CID 12026596) has the molecular formula C32H26NO3P and a molecular weight of 503.54 g/mol. Its IUPAC name is (5Z)-5-[hydroxy(phenyl)methylidene]-10b-phenyl-3-(2,4,6-trimethylphenyl)isophosphinolino[2,1-d][1,2,4]oxazaphosphol-6-one.
| Compound Name | (5Z)-5-[hydroxy(phenyl)methylidene]-10b-phenyl-3-(2,4,6-trimethylphenyl)isophosphinolino[2,1-d][1,2,4]oxazaphosphol-6-one |
|---|---|
| PubChem CID | 12026596 |
| Molecular Formula | C32H26NO3P |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (5Z)-5-[hydroxy(phenyl)methylidene]-10b-phenyl-3-(2,4,6-trimethylphenyl)isophosphinolino[2,1-d][1,2,4]oxazaphosphol-6-one |
| SMILES | Cc1cc(C)c(C2=NOC3(c4ccccc4)c4ccccc4C(=O)/C(=C(/O)c4ccccc4)P23)c(C)c1 |
| InChI | InChI=1S/C32H26NO3P/c1-20-18-21(2)27(22(3)19-20)31-33-36-32(24-14-8-5-9-15-24)26-17-11-10-16-25(26)29(35)30(37(31)32)28(34)23-12-6-4-7-13-23/h4-19,34H,1-3H3/b30-28- |
| InChIKey | MCCTYNBZGNYCLH-HYOGKJQXSA-N |
| XLogP | 7.81 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|