About triazolo[4,5-h]quinolin-1-ylmethanol
triazolo[4,5-h]quinolin-1-ylmethanol (PubChem CID 12026627) has the molecular formula C10H8N4O
and a molecular weight of 200.20 g/mol. Its IUPAC name is triazolo[4,5-h]quinolin-1-ylmethanol.
Molecular Properties
| Compound Name | triazolo[4,5-h]quinolin-1-ylmethanol |
| PubChem CID | 12026627 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | triazolo[4,5-h]quinolin-1-ylmethanol |
| SMILES | OCn1nnc2ccc3cccnc3c21 |
| InChI | InChI=1S/C10H8N4O/c15-6-14-10-8(12-13-14)4-3-7-2-1-5-11-9(7)10/h1-5,15H,6H2 |
| InChIKey | WKEWMDOFOHFGJJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze triazolo[4,5-h]quinolin-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triazolo[4,5-h]quinolin-1-ylmethanol?
The IUPAC name of triazolo[4,5-h]quinolin-1-ylmethanol (CID 12026627) is triazolo[4,5-h]quinolin-1-ylmethanol.
What is the SMILES notation for triazolo[4,5-h]quinolin-1-ylmethanol?
The canonical SMILES for triazolo[4,5-h]quinolin-1-ylmethanol is OCn1nnc2ccc3cccnc3c21.
What is the InChIKey of triazolo[4,5-h]quinolin-1-ylmethanol?
The InChIKey is WKEWMDOFOHFGJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O/c15-6-14-10-8(12-13-14)4-3-7-2-1-5-11-9(7)10/h1-5,15H,6H2.
What are the key properties of triazolo[4,5-h]quinolin-1-ylmethanol?
triazolo[4,5-h]quinolin-1-ylmethanol has a molecular weight of 200.20 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for triazolo[4,5-h]quinolin-1-ylmethanol is sourced from PubChem (CID 12026627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).