About [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate
[3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate (PubChem CID 12026822) has the molecular formula C16H16F3NO3S
and a molecular weight of 359.37 g/mol. Its IUPAC name is [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 12026822 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cccnc1-c1c(OS(=O)(=O)C(F)(F)F)cc(C)c(C)c1C |
| InChI | InChI=1S/C16H16F3NO3S/c1-9-6-5-7-20-15(9)14-12(4)11(3)10(2)8-13(14)23-24(21,22)16(17,18)19/h5-8H,1-4H3 |
| InChIKey | BNMYSYQCLJWKPI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate (CID 12026822) is [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate is Cc1cccnc1-c1c(OS(=O)(=O)C(F)(F)F)cc(C)c(C)c1C.
What is the InChIKey of [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate?
The InChIKey is BNMYSYQCLJWKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F3NO3S/c1-9-6-5-7-20-15(9)14-12(4)11(3)10(2)8-13(14)23-24(21,22)16(17,18)19/h5-8H,1-4H3.
What are the key properties of [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate?
[3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate has a molecular weight of 359.37 g/mol, XLogP of 4.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4,5-trimethyl-2-(3-methyl-2-pyridinyl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 12026822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).