C14H13ClS — CID 12026855
1-(2-chlorophenyl)sulfanyl-3,5-dimethylbenzene (PubChem CID 12026855) has the molecular formula C14H13ClS and a molecular weight of 248.78 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfanyl-3,5-dimethylbenzene.
| Compound Name | 1-(2-chlorophenyl)sulfanyl-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 12026855 |
| Molecular Formula | C14H13ClS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 1-(2-chlorophenyl)sulfanyl-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(Sc2ccccc2Cl)c1 |
| InChI | InChI=1S/C14H13ClS/c1-10-7-11(2)9-12(8-10)16-14-6-4-3-5-13(14)15/h3-9H,1-2H3 |
| InChIKey | WYBOVQSLTRSFET-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |