About dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate
dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate (PubChem CID 12026984) has the molecular formula C16H30O5Si
and a molecular weight of 330.50 g/mol. Its IUPAC name is dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
| PubChem CID | 12026984 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)C(C[Si](C)(C)OC(C)C)C1 |
| InChI | InChI=1S/C16H30O5Si/c1-11(2)21-22(6,7)10-13-9-16(8-12(13)3,14(17)19-4)15(18)20-5/h11-13H,8-10H2,1-7H3 |
| InChIKey | FZCOFICKDIWQMX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate?
The IUPAC name of dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate (CID 12026984) is dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate.
What is the SMILES notation for dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate?
The canonical SMILES for dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate is COC(=O)C1(C(=O)OC)CC(C)C(C[Si](C)(C)OC(C)C)C1.
What is the InChIKey of dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate?
The InChIKey is FZCOFICKDIWQMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O5Si/c1-11(2)21-22(6,7)10-13-9-16(8-12(13)3,14(17)19-4)15(18)20-5/h11-13H,8-10H2,1-7H3.
What are the key properties of dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate?
dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate has a molecular weight of 330.50 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-[[dimethyl(propan-2-yloxy)silyl]methyl]-4-methylcyclopentane-1,1-dicarboxylate is sourced from PubChem (CID 12026984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).