About N-propylcinnolin-4-amine
N-propylcinnolin-4-amine (PubChem CID 12027104) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is N-propylcinnolin-4-amine.
Molecular Properties
| Compound Name | N-propylcinnolin-4-amine |
| PubChem CID | 12027104 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | N-propylcinnolin-4-amine |
| SMILES | CCCNc1cnnc2ccccc12 |
| InChI | InChI=1S/C11H13N3/c1-2-7-12-11-8-13-14-10-6-4-3-5-9(10)11/h3-6,8H,2,7H2,1H3,(H,12,14) |
| InChIKey | YCFLURDIMNFRGV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-propylcinnolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylcinnolin-4-amine?
The IUPAC name of N-propylcinnolin-4-amine (CID 12027104) is N-propylcinnolin-4-amine.
What is the SMILES notation for N-propylcinnolin-4-amine?
The canonical SMILES for N-propylcinnolin-4-amine is CCCNc1cnnc2ccccc12.
What is the InChIKey of N-propylcinnolin-4-amine?
The InChIKey is YCFLURDIMNFRGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-2-7-12-11-8-13-14-10-6-4-3-5-9(10)11/h3-6,8H,2,7H2,1H3,(H,12,14).
What are the key properties of N-propylcinnolin-4-amine?
N-propylcinnolin-4-amine has a molecular weight of 187.25 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylcinnolin-4-amine is sourced from PubChem (CID 12027104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).