C12H18OSi — CID 12027223
3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one (PubChem CID 12027223) has the molecular formula C12H18OSi and a molecular weight of 206.36 g/mol. Its IUPAC name is 3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one.
| Compound Name | 3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 12027223 |
| Molecular Formula | C12H18OSi |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3-trimethylsilyl-1,4,5,6-tetrahydroinden-2-one |
| SMILES | C[Si](C)(C)C1=C2CCCC=C2CC1=O |
| InChI | InChI=1S/C12H18OSi/c1-14(2,3)12-10-7-5-4-6-9(10)8-11(12)13/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | MQTHJKMBXDAFRR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|