C17H30O — CID 12027231
2,3,4,5-tetrapropylcyclopent-3-en-1-one (PubChem CID 12027231) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 2,3,4,5-tetrapropylcyclopent-3-en-1-one.
| Compound Name | 2,3,4,5-tetrapropylcyclopent-3-en-1-one |
|---|---|
| PubChem CID | 12027231 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 2,3,4,5-tetrapropylcyclopent-3-en-1-one |
| SMILES | CCCC1=C(CCC)C(CCC)C(=O)C1CCC |
| InChI | InChI=1S/C17H30O/c1-5-9-13-14(10-6-2)16(12-8-4)17(18)15(13)11-7-3/h15-16H,5-12H2,1-4H3 |
| InChIKey | WZEZNAGWIXQECY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|